C15H11BrFNO4 — CID 14695623
3-(4-bromo-2-fluoro-5-prop-2-ynoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione (PubChem CID 14695623) has the molecular formula C15H11BrFNO4 and a molecular weight of 368.16 g/mol. Its IUPAC name is 3-(4-bromo-2-fluoro-5-prop-2-ynoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione.
| Compound Name | 3-(4-bromo-2-fluoro-5-prop-2-ynoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 14695623 |
| Molecular Formula | C15H11BrFNO4 |
| Molecular Weight | 368.16 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-(4-bromo-2-fluoro-5-prop-2-ynoxyphenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| SMILES | C#CCOc1cc(N2C(=O)OC(=C(C)C)C2=O)c(F)cc1Br |
| InChI | InChI=1S/C15H11BrFNO4/c1-4-5-21-12-7-11(10(17)6-9(12)16)18-14(19)13(8(2)3)22-15(18)20/h1,6-7H,5H2,2-3H3 |
| InChIKey | NPVNLIRTDQAHTH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|