C18H18BrF4NO5 — CID 54007307
1-[4-bromo-2-fluoro-5-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 54007307) has the molecular formula C18H18BrF4NO5 and a molecular weight of 484.24 g/mol. Its IUPAC name is 1-[4-bromo-2-fluoro-5-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[4-bromo-2-fluoro-5-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 54007307 |
| Molecular Formula | C18H18BrF4NO5 |
| Molecular Weight | 484.24 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 1-[4-bromo-2-fluoro-5-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]phenyl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(c2cc(OCCOCCOCC(F)(F)F)c(Br)cc2F)C1=O |
| InChI | InChI=1S/C18H18BrF4NO5/c1-10-11(2)17(26)24(16(10)25)14-8-15(12(19)7-13(14)20)29-6-5-27-3-4-28-9-18(21,22)23/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | KPUJTFCMZXINFL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|