C28H25ClF4N2O6 — CID 146958342
4-[3-[[1-(4-chlorophenyl)-2-[5-fluoro-6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]-2-hydroxyethenyl]amino]-5-methoxyphenoxy]butanoic acid (PubChem CID 146958342) has the molecular formula C28H25ClF4N2O6 and a molecular weight of 596.96 g/mol. Its IUPAC name is 4-[3-[[1-(4-chlorophenyl)-2-[5-fluoro-6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]-2-hydroxyethenyl]amino]-5-methoxyphenoxy]butanoic acid.
| Compound Name | 4-[3-[[1-(4-chlorophenyl)-2-[5-fluoro-6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]-2-hydroxyethenyl]amino]-5-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 146958342 |
| Molecular Formula | C28H25ClF4N2O6 |
| Molecular Weight | 596.96 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | 4-[3-[[1-(4-chlorophenyl)-2-[5-fluoro-6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]-2-hydroxyethenyl]amino]-5-methoxyphenoxy]butanoic acid |
| SMILES | COc1cc(NC(=C(O)N2CCc3cc(F)c(OC(F)(F)F)cc32)c2ccc(Cl)cc2)cc(OCCCC(=O)O)c1 |
| InChI | InChI=1S/C28H25ClF4N2O6/c1-39-20-12-19(13-21(14-20)40-10-2-3-25(36)37)34-26(16-4-6-18(29)7-5-16)27(38)35-9-8-17-11-22(30)24(15-23(17)35)41-28(31,32)33/h4-7,11-15,34,38H,2-3,8-10H2,1H3,(H,36,37) |
| InChIKey | AYUVCVGLOWOEAT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.96 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|