C28H25ClF3N2O6+ — CID 163199712
[3-(3-carboxypropoxy)-5-methoxyphenyl]-[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethylidene]azanium (PubChem CID 163199712) has the molecular formula C28H25ClF3N2O6+ and a molecular weight of 577.96 g/mol. Its IUPAC name is [3-(3-carboxypropoxy)-5-methoxyphenyl]-[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethylidene]azanium.
| Compound Name | [3-(3-carboxypropoxy)-5-methoxyphenyl]-[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethylidene]azanium |
|---|---|
| PubChem CID | 163199712 |
| Molecular Formula | C28H25ClF3N2O6+ |
| Molecular Weight | 577.96 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | [3-(3-carboxypropoxy)-5-methoxyphenyl]-[1-(4-chlorophenyl)-2-oxo-2-[6-(trifluoromethoxy)-2,3-dihydroindol-1-yl]ethylidene]azanium |
| SMILES | COc1cc(/[NH+]=C(/C(=O)N2CCc3ccc(OC(F)(F)F)cc32)c2ccc(Cl)cc2)cc(OCCCC(=O)O)c1 |
| InChI | InChI=1S/C28H24ClF3N2O6/c1-38-22-13-20(14-23(15-22)39-12-2-3-25(35)36)33-26(18-4-7-19(29)8-5-18)27(37)34-11-10-17-6-9-21(16-24(17)34)40-28(30,31)32/h4-9,13-16H,2-3,10-12H2,1H3,(H,35,36)/p+1/b33-26+ |
| InChIKey | RTAGDFPMOHHOJZ-MHTZHOPKSA-O |
| XLogP | 4.28 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.96 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|