C27H26ClF5N2O5S — CID 158904984
4-[3-[[1-(4-chlorophenyl)-2-hydroxy-2-[6-(pentafluoro-λ6-sulfanyl)-2,3-dihydroindol-1-yl]ethenyl]amino]-5-methoxyphenoxy]butanoic acid (PubChem CID 158904984) has the molecular formula C27H26ClF5N2O5S and a molecular weight of 621.02 g/mol. Its IUPAC name is 4-[3-[[1-(4-chlorophenyl)-2-hydroxy-2-[6-(pentafluoro-λ6-sulfanyl)-2,3-dihydroindol-1-yl]ethenyl]amino]-5-methoxyphenoxy]butanoic acid.
| Compound Name | 4-[3-[[1-(4-chlorophenyl)-2-hydroxy-2-[6-(pentafluoro-λ6-sulfanyl)-2,3-dihydroindol-1-yl]ethenyl]amino]-5-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 158904984 |
| Molecular Formula | C27H26ClF5N2O5S |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | 4-[3-[[1-(4-chlorophenyl)-2-hydroxy-2-[6-(pentafluoro-λ6-sulfanyl)-2,3-dihydroindol-1-yl]ethenyl]amino]-5-methoxyphenoxy]butanoic acid |
| SMILES | COc1cc(NC(=C(O)N2CCc3ccc(S(F)(F)(F)(F)F)cc32)c2ccc(Cl)cc2)cc(OCCCC(=O)O)c1 |
| InChI | InChI=1S/C27H26ClF5N2O5S/c1-39-21-13-20(14-22(15-21)40-12-2-3-25(36)37)34-26(18-4-7-19(28)8-5-18)27(38)35-11-10-17-6-9-23(16-24(17)35)41(29,30,31,32)33/h4-9,13-16,34,38H,2-3,10-12H2,1H3,(H,36,37) |
| InChIKey | NNHWJVYRONDCHP-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|