C16H24O — CID 14697675
(1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidenetricyclo[8.2.0.04,6]dodecan-5-one (PubChem CID 14697675) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidenetricyclo[8.2.0.04,6]dodecan-5-one.
| Compound Name | (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidenetricyclo[8.2.0.04,6]dodecan-5-one |
|---|---|
| PubChem CID | 14697675 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1R,4R,6R,10S)-4,12,12-trimethyl-9-methylidenetricyclo[8.2.0.04,6]dodecan-5-one |
| SMILES | C=C1CC[C@H]2C(=O)[C@]2(C)CC[C@@H]2[C@@H]1CC2(C)C |
| InChI | InChI=1S/C16H24O/c1-10-5-6-13-14(17)16(13,4)8-7-12-11(10)9-15(12,2)3/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+,16-/m1/s1 |
| InChIKey | SNVUDGMIDCJEIG-NFFDBFGFSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|