C20H32O2 — CID 163024915
(1S,6R,9R,10R)-6,10-dimethyl-2-methylidene-10-(4-methyl-3-oxopentyl)bicyclo[7.2.0]undecan-5-one (PubChem CID 163024915) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,6R,9R,10R)-6,10-dimethyl-2-methylidene-10-(4-methyl-3-oxopentyl)bicyclo[7.2.0]undecan-5-one.
| Compound Name | (1S,6R,9R,10R)-6,10-dimethyl-2-methylidene-10-(4-methyl-3-oxopentyl)bicyclo[7.2.0]undecan-5-one |
|---|---|
| PubChem CID | 163024915 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,6R,9R,10R)-6,10-dimethyl-2-methylidene-10-(4-methyl-3-oxopentyl)bicyclo[7.2.0]undecan-5-one |
| SMILES | C=C1CCC(=O)[C@H](C)CC[C@@H]2[C@@H]1C[C@@]2(C)CCC(=O)C(C)C |
| InChI | InChI=1S/C20H32O2/c1-13(2)18(21)10-11-20(5)12-16-14(3)7-9-19(22)15(4)6-8-17(16)20/h13,15-17H,3,6-12H2,1-2,4-5H3/t15-,16-,17-,20-/m1/s1 |
| InChIKey | SMNZXLXIDCNTEY-WOCWXWTJSA-N |
| XLogP | 4.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|