C18H30O2 — CID 23426353
(E)-4-methyl-1-[(1R,2S)-1-methyl-2-propan-2-ylcyclobutyl]non-4-ene-1,8-dione (PubChem CID 23426353) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (E)-4-methyl-1-[(1R,2S)-1-methyl-2-propan-2-ylcyclobutyl]non-4-ene-1,8-dione.
| Compound Name | (E)-4-methyl-1-[(1R,2S)-1-methyl-2-propan-2-ylcyclobutyl]non-4-ene-1,8-dione |
|---|---|
| PubChem CID | 23426353 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (E)-4-methyl-1-[(1R,2S)-1-methyl-2-propan-2-ylcyclobutyl]non-4-ene-1,8-dione |
| SMILES | CC(=O)CC/C=C(\C)CCC(=O)[C@]1(C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C18H30O2/c1-13(2)16-11-12-18(16,5)17(20)10-9-14(3)7-6-8-15(4)19/h7,13,16H,6,8-12H2,1-5H3/b14-7+/t16-,18+/m0/s1 |
| InChIKey | IGJMOONLKHMHNY-AFMAJOOXSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|