About (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate
(4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate (PubChem CID 146994451) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate.
Analyze (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate?
The IUPAC name of (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate (CID 146994451) is (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate.
What is the SMILES notation for (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate?
The canonical SMILES for (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate is Cc1ccc(C(=O)OC23CC4CC(C)C5CC2(C3)C45)cc1.
What is the InChIKey of (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate?
The InChIKey is AQUUCHJQHGJOGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2/c1-11-3-5-13(6-4-11)17(20)21-19-8-14-7-12(2)15-9-18(19,10-19)16(14)15/h3-6,12,14-16H,7-10H2,1-2H3.
What are the key properties of (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate?
(4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate has a molecular weight of 282.38 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-8-tetracyclo[4.3.1.01,8.03,10]decanyl) 4-methylbenzoate is sourced from PubChem (CID 146994451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).