About N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine
N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine (PubChem CID 147004153) has the molecular formula C23H13F6N5
and a molecular weight of 473.38 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine |
| PubChem CID | 147004153 |
| Molecular Formula | C23H13F6N5 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine |
| SMILES | FC(F)(F)c1cc(Nc2nnc(-c3ccc4c(c3)CN=N4)c3ccccc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H13F6N5/c24-22(25,26)14-8-15(23(27,28)29)10-16(9-14)31-21-18-4-2-1-3-17(18)20(33-34-21)12-5-6-19-13(7-12)11-30-32-19/h1-10H,11H2,(H,31,34) |
| InChIKey | ASPOKAYJIWPOPM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine (CID 147004153) is N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine is FC(F)(F)c1cc(Nc2nnc(-c3ccc4c(c3)CN=N4)c3ccccc23)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine?
The InChIKey is ASPOKAYJIWPOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13F6N5/c24-22(25,26)14-8-15(23(27,28)29)10-16(9-14)31-21-18-4-2-1-3-17(18)20(33-34-21)12-5-6-19-13(7-12)11-30-32-19/h1-10H,11H2,(H,31,34).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine?
N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine has a molecular weight of 473.38 g/mol, XLogP of 7.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-4-(3H-indazol-5-yl)phthalazin-1-amine is sourced from PubChem (CID 147004153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).