C19H17F3N4O — CID 169259386
(3S,4R)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-3-ol (PubChem CID 169259386) has the molecular formula C19H17F3N4O and a molecular weight of 374.37 g/mol. Its IUPAC name is (3S,4R)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-3-ol.
| Compound Name | (3S,4R)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 169259386 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (3S,4R)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-3-ol |
| SMILES | O[C@H]1CNC[C@H]1Nc1nnc(-c2ccc(C(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H17F3N4O/c20-19(21,22)12-7-5-11(6-8-12)17-13-3-1-2-4-14(13)18(26-25-17)24-15-9-23-10-16(15)27/h1-8,15-16,23,27H,9-10H2,(H,24,26)/t15-,16+/m1/s1 |
| InChIKey | NGENMTSAZKBUAJ-CVEARBPZSA-N |
| XLogP | 3.06 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |