C22H19F3N4O2 — CID 169259307
1-[(3S,4R)-3-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 169259307) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is 1-[(3S,4R)-3-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S,4R)-3-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 169259307 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-[(3S,4R)-3-hydroxy-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](O)[C@H](Nc2nnc(-c3ccc(C(F)(F)F)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C22H19F3N4O2/c1-2-19(31)29-11-17(18(30)12-29)26-21-16-6-4-3-5-15(16)20(27-28-21)13-7-9-14(10-8-13)22(23,24)25/h2-10,17-18,30H,1,11-12H2,(H,26,28)/t17-,18+/m1/s1 |
| InChIKey | KCTNHEDMDCMEPD-MSOLQXFVSA-N |
| XLogP | 3.49 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|