C21H20F3N3O3 — CID 169259706
3-(methoxymethyl)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]oxolan-3-ol (PubChem CID 169259706) has the molecular formula C21H20F3N3O3 and a molecular weight of 419.40 g/mol. Its IUPAC name is 3-(methoxymethyl)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]oxolan-3-ol.
| Compound Name | 3-(methoxymethyl)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]oxolan-3-ol |
|---|---|
| PubChem CID | 169259706 |
| Molecular Formula | C21H20F3N3O3 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-(methoxymethyl)-4-[[4-[4-(trifluoromethyl)phenyl]phthalazin-1-yl]amino]oxolan-3-ol |
| SMILES | COCC1(O)COCC1Nc1nnc(-c2ccc(C(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C21H20F3N3O3/c1-29-11-20(28)12-30-10-17(20)25-19-16-5-3-2-4-15(16)18(26-27-19)13-6-8-14(9-7-13)21(22,23)24/h2-9,17,28H,10-12H2,1H3,(H,25,27) |
| InChIKey | BDPRQBDIICUXNM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |