C34H37N5O6 — CID 147004204
ethyl 6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]pyridine-2-carboxylate (PubChem CID 147004204) has the molecular formula C34H37N5O6 and a molecular weight of 611.70 g/mol. Its IUPAC name is ethyl 6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]pyridine-2-carboxylate.
| Compound Name | ethyl 6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 147004204 |
| Molecular Formula | C34H37N5O6 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | ethyl 6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]pyridine-2-carboxylate |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccc(C(=O)OCC)n3)C[C@@H]2N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C34H37N5O6/c1-3-19-37-23-32(42)38-29(20-25-13-16-27(40)17-14-25)33(43)36(21-26-11-8-12-28(35-26)34(44)45-4-2)22-30(38)39(37)31(41)18-15-24-9-6-5-7-10-24/h3,5-14,16-17,29-30,40H,1,4,15,18-23H2,2H3/t29-,30-/m0/s1 |
| InChIKey | ASPVPQIMRRMEPS-KYJUHHDHSA-N |
| XLogP | 2.95 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|