C33H33N5O9 — CID 160749993
[6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]-1,3-benzodioxol-5-yl] nitrate (PubChem CID 160749993) has the molecular formula C33H33N5O9 and a molecular weight of 643.65 g/mol. Its IUPAC name is [6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]-1,3-benzodioxol-5-yl] nitrate.
| Compound Name | [6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]-1,3-benzodioxol-5-yl] nitrate |
|---|---|
| PubChem CID | 160749993 |
| Molecular Formula | C33H33N5O9 |
| Molecular Weight | 643.65 g/mol |
| Exact Mass | 643.23 |
| IUPAC Name | [6-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]-1,3-benzodioxol-5-yl] nitrate |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cc4c(cc3O[N+](=O)[O-])OCO4)C[C@@H]2N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C33H33N5O9/c1-2-14-35-20-32(41)36-26(15-23-8-11-25(39)12-9-23)33(42)34(18-24-16-28-29(46-21-45-28)17-27(24)47-38(43)44)19-30(36)37(35)31(40)13-10-22-6-4-3-5-7-22/h2-9,11-12,16-17,26,30,39H,1,10,13-15,18-21H2/t26-,30-/m0/s1 |
| InChIKey | RWRMTEIYAXGJPU-YZNIXAGQSA-N |
| XLogP | 2.68 |
| TPSA | 155.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.65 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|