C32H32N6O8 — CID 72530690
N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 72530690) has the molecular formula C32H32N6O8 and a molecular weight of 628.64 g/mol. Its IUPAC name is N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 72530690 |
| Molecular Formula | C32H32N6O8 |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2C(Cc3ccc(O)cc3)C(=O)N(Cc3cc4c(cc3[N+](=O)[O-])OCO4)CC2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H32N6O8/c1-2-12-35-19-30(40)36-26(13-21-8-10-24(39)11-9-21)31(41)34(17-23-14-27-28(46-20-45-27)15-25(23)38(43)44)18-29(36)37(35)32(42)33-16-22-6-4-3-5-7-22/h2-11,14-15,26,29,39H,1,12-13,16-20H2,(H,33,42) |
| InChIKey | SLOBGNGMPAKVEG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 158.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|