C39H38N4O6 — CID 159971657
3-[3-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]phenyl]benzoic acid (PubChem CID 159971657) has the molecular formula C39H38N4O6 and a molecular weight of 658.76 g/mol. Its IUPAC name is 3-[3-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]phenyl]benzoic acid.
| Compound Name | 3-[3-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 159971657 |
| Molecular Formula | C39H38N4O6 |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 3-[3-[[(6S,9aS)-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-1-(3-phenylpropanoyl)-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-8-yl]methyl]phenyl]benzoic acid |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccc(-c4cccc(C(=O)O)c4)c3)C[C@@H]2N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C39H38N4O6/c1-2-20-41-26-37(46)42-34(22-28-14-17-33(44)18-15-28)38(47)40(25-35(42)43(41)36(45)19-16-27-8-4-3-5-9-27)24-29-10-6-11-30(21-29)31-12-7-13-32(23-31)39(48)49/h2-15,17-18,21,23,34-35,44H,1,16,19-20,22,24-26H2,(H,48,49)/t34-,35-/m0/s1 |
| InChIKey | OEPWBOSFYXNEDC-PXLJZGITSA-N |
| XLogP | 4.74 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|