C15H21NOS — CID 147017160
1-[(1R)-3-propan-2-ylcyclohex-2-en-1-yl]-3-(1,3-thiazol-2-yl)propan-2-one (PubChem CID 147017160) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is 1-[(1R)-3-propan-2-ylcyclohex-2-en-1-yl]-3-(1,3-thiazol-2-yl)propan-2-one.
| Compound Name | 1-[(1R)-3-propan-2-ylcyclohex-2-en-1-yl]-3-(1,3-thiazol-2-yl)propan-2-one |
|---|---|
| PubChem CID | 147017160 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-[(1R)-3-propan-2-ylcyclohex-2-en-1-yl]-3-(1,3-thiazol-2-yl)propan-2-one |
| SMILES | CC(C)C1=C[C@@H](CC(=O)Cc2nccs2)CCC1 |
| InChI | InChI=1S/C15H21NOS/c1-11(2)13-5-3-4-12(8-13)9-14(17)10-15-16-6-7-18-15/h6-8,11-12H,3-5,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | AUZPVWVUESGZQJ-LBPRGKRZSA-N |
| XLogP | 4.03 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|