C7H13F2NO4S — CID 147017692
(4R,5S)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol (PubChem CID 147017692) has the molecular formula C7H13F2NO4S and a molecular weight of 245.25 g/mol. Its IUPAC name is (4R,5S)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol.
| Compound Name | (4R,5S)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 147017692 |
| Molecular Formula | C7H13F2NO4S |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | (4R,5S)-5-(difluoromethyl)-1-methylsulfonylpiperidine-3,4-diol |
| SMILES | CS(=O)(=O)N1CC(O)[C@H](O)[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C7H13F2NO4S/c1-15(13,14)10-2-4(7(8)9)6(12)5(11)3-10/h4-7,11-12H,2-3H2,1H3/t4-,5?,6+/m0/s1 |
| InChIKey | AVCABTLYFCCNDB-NOWQFEBASA-N |
| XLogP | -1.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |