C11H15FN2 — CID 147059226
(1Z,3Z)-1-(3-fluorocyclohexa-1,5-dien-1-yl)penta-1,3-diene-1,4-diamine (PubChem CID 147059226) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is (1Z,3Z)-1-(3-fluorocyclohexa-1,5-dien-1-yl)penta-1,3-diene-1,4-diamine.
| Compound Name | (1Z,3Z)-1-(3-fluorocyclohexa-1,5-dien-1-yl)penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 147059226 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | (1Z,3Z)-1-(3-fluorocyclohexa-1,5-dien-1-yl)penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)C1=CC(F)CC=C1 |
| InChI | InChI=1S/C11H15FN2/c1-8(13)5-6-11(14)9-3-2-4-10(12)7-9/h2-3,5-7,10H,4,13-14H2,1H3/b8-5-,11-6- |
| InChIKey | BCVRKOTYROIHTG-IGJCCDITSA-N |
| XLogP | 1.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|