C16H14F2NO2+ — CID 147060460
(6R)-6-(2,3-difluorophenyl)-1-hydroxy-5,6,7,8-tetrahydrocyclohepta[b]pyridin-1-ium-9-one (PubChem CID 147060460) has the molecular formula C16H14F2NO2+ and a molecular weight of 290.29 g/mol. Its IUPAC name is (6R)-6-(2,3-difluorophenyl)-1-hydroxy-5,6,7,8-tetrahydrocyclohepta[b]pyridin-1-ium-9-one.
| Compound Name | (6R)-6-(2,3-difluorophenyl)-1-hydroxy-5,6,7,8-tetrahydrocyclohepta[b]pyridin-1-ium-9-one |
|---|---|
| PubChem CID | 147060460 |
| Molecular Formula | C16H14F2NO2+ |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (6R)-6-(2,3-difluorophenyl)-1-hydroxy-5,6,7,8-tetrahydrocyclohepta[b]pyridin-1-ium-9-one |
| SMILES | O=C1CC[C@@H](c2cccc(F)c2F)Cc2ccc[n+](O)c21 |
| InChI | InChI=1S/C16H14F2NO2/c17-13-5-1-4-12(15(13)18)10-6-7-14(20)16-11(9-10)3-2-8-19(16)21/h1-5,8,10,21H,6-7,9H2/q+1/t10-/m1/s1 |
| InChIKey | BDBJWJMJLFTWGR-SNVBAGLBSA-N |
| XLogP | 2.79 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|