C16H15F2N — CID 115502761
2-(2,3-difluorophenyl)-3-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 115502761) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-3-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-(2,3-difluorophenyl)-3-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 115502761 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(2,3-difluorophenyl)-3-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1Cc2ccccc2NC1c1cccc(F)c1F |
| InChI | InChI=1S/C16H15F2N/c1-10-9-11-5-2-3-8-14(11)19-16(10)12-6-4-7-13(17)15(12)18/h2-8,10,16,19H,9H2,1H3 |
| InChIKey | MXZDXDSETWOZBN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |