C24H15ClN4 — CID 147064313
8-[3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline (PubChem CID 147064313) has the molecular formula C24H15ClN4 and a molecular weight of 394.87 g/mol. Its IUPAC name is 8-[3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline.
| Compound Name | 8-[3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 147064313 |
| Molecular Formula | C24H15ClN4 |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 8-[3-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]isoquinoline |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2cccc(-c3cccc4ccncc34)c2)n1 |
| InChI | InChI=1S/C24H15ClN4/c25-24-28-22(17-6-2-1-3-7-17)27-23(29-24)19-10-4-9-18(14-19)20-11-5-8-16-12-13-26-15-21(16)20/h1-15H |
| InChIKey | BDTRVQPZWJNISP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |