C6H7ClIN3 — CID 147070006
6-chloro-N-ethyl-2-iodopyrimidin-4-amine (PubChem CID 147070006) has the molecular formula C6H7ClIN3 and a molecular weight of 283.50 g/mol. Its IUPAC name is 6-chloro-N-ethyl-2-iodopyrimidin-4-amine.
| Compound Name | 6-chloro-N-ethyl-2-iodopyrimidin-4-amine |
|---|---|
| PubChem CID | 147070006 |
| Molecular Formula | C6H7ClIN3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 282.94 |
| IUPAC Name | 6-chloro-N-ethyl-2-iodopyrimidin-4-amine |
| SMILES | CCNc1cc(Cl)nc(I)n1 |
| InChI | InChI=1S/C6H7ClIN3/c1-2-9-5-3-4(7)10-6(8)11-5/h3H,2H2,1H3,(H,9,10,11) |
| InChIKey | BEVXXHDGKCTYRI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|