About methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate
methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate (PubChem CID 147079321) has the molecular formula C8H5ClN2O4
and a molecular weight of 228.59 g/mol. Its IUPAC name is methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate.
Analyze methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate?
The IUPAC name of methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate (CID 147079321) is methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate.
What is the SMILES notation for methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate?
The canonical SMILES for methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate is COC(=O)c1oc2cc(Cl)nnc2c1O.
What is the InChIKey of methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate?
The InChIKey is BGPCTTLUXQJQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O4/c1-14-8(13)7-6(12)5-3(15-7)2-4(9)10-11-5/h2,12H,1H3.
What are the key properties of methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate?
methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate has a molecular weight of 228.59 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chloro-7-hydroxyfuro[3,2-c]pyridazine-6-carboxylate is sourced from PubChem (CID 147079321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).