C28H24ClFN2O5 — CID 147086452
2-[4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-nitrophenyl)-2-oxobutyl]cyclopentane-1,3-dione (PubChem CID 147086452) has the molecular formula C28H24ClFN2O5 and a molecular weight of 522.96 g/mol. Its IUPAC name is 2-[4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-nitrophenyl)-2-oxobutyl]cyclopentane-1,3-dione.
| Compound Name | 2-[4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-nitrophenyl)-2-oxobutyl]cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 147086452 |
| Molecular Formula | C28H24ClFN2O5 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2-[4-(5-chloro-3-fluoro-2-pyridinyl)-2,6-dimethylphenyl]-4-[4-(3-nitrophenyl)-2-oxobutyl]cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ncc(Cl)cc2F)cc(C)c1C1C(=O)CC(CC(=O)CCc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C28H24ClFN2O5/c1-15-8-18(27-23(30)13-20(29)14-31-27)9-16(2)25(15)26-24(34)12-19(28(26)35)11-22(33)7-6-17-4-3-5-21(10-17)32(36)37/h3-5,8-10,13-14,19,26H,6-7,11-12H2,1-2H3 |
| InChIKey | YOTWJXKTGMOGMT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 107.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|