C16H28N2O6S — CID 147091244
3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(oxan-4-ylsulfonyl)propanoyl]pent-2-enamide (PubChem CID 147091244) has the molecular formula C16H28N2O6S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(oxan-4-ylsulfonyl)propanoyl]pent-2-enamide.
| Compound Name | 3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(oxan-4-ylsulfonyl)propanoyl]pent-2-enamide |
|---|---|
| PubChem CID | 147091244 |
| Molecular Formula | C16H28N2O6S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 3-amino-5-hydroxy-4,4-dimethyl-N-[2-methyl-2-(oxan-4-ylsulfonyl)propanoyl]pent-2-enamide |
| SMILES | CC(C)(CO)C(N)=CC(=O)NC(=O)C(C)(C)S(=O)(=O)C1CCOCC1 |
| InChI | InChI=1S/C16H28N2O6S/c1-15(2,10-19)12(17)9-13(20)18-14(21)16(3,4)25(22,23)11-5-7-24-8-6-11/h9,11,19H,5-8,10,17H2,1-4H3,(H,18,20,21) |
| InChIKey | LITCMHCFVXBHIZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|