C20H23N3OS — CID 14709284
N-(2,6-dimethylphenyl)-4-methyl-2-phenylimino-1,3-thiazinane-3-carboxamide (PubChem CID 14709284) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-4-methyl-2-phenylimino-1,3-thiazinane-3-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-4-methyl-2-phenylimino-1,3-thiazinane-3-carboxamide |
|---|---|
| PubChem CID | 14709284 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-(2,6-dimethylphenyl)-4-methyl-2-phenylimino-1,3-thiazinane-3-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)N1/C(=N/c2ccccc2)SCCC1C |
| InChI | InChI=1S/C20H23N3OS/c1-14-8-7-9-15(2)18(14)22-19(24)23-16(3)12-13-25-20(23)21-17-10-5-4-6-11-17/h4-11,16H,12-13H2,1-3H3,(H,22,24)/b21-20- |
| InChIKey | LMAPIXYPSHRFIN-MRCUWXFGSA-N |
| XLogP | 5.35 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|