C22H25FO4 — CID 147101331
5-[2-(3-fluorophenyl)-4-(5-hydroxyoxan-2-yl)oxyphenyl]pentan-2-one (PubChem CID 147101331) has the molecular formula C22H25FO4 and a molecular weight of 372.44 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)-4-(5-hydroxyoxan-2-yl)oxyphenyl]pentan-2-one.
| Compound Name | 5-[2-(3-fluorophenyl)-4-(5-hydroxyoxan-2-yl)oxyphenyl]pentan-2-one |
|---|---|
| PubChem CID | 147101331 |
| Molecular Formula | C22H25FO4 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-[2-(3-fluorophenyl)-4-(5-hydroxyoxan-2-yl)oxyphenyl]pentan-2-one |
| SMILES | CC(=O)CCCc1ccc(OC2CCC(O)CO2)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H25FO4/c1-15(24)4-2-5-16-8-10-20(27-22-11-9-19(25)14-26-22)13-21(16)17-6-3-7-18(23)12-17/h3,6-8,10,12-13,19,22,25H,2,4-5,9,11,14H2,1H3 |
| InChIKey | BKSDKVKQDFOAHR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |