C25H30FNO6 — CID 153364985
N-[2-[4-[(2S,3R,4S,5R,6R)-3,4-dihydroxy-5-methoxy-6-prop-2-enyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide (PubChem CID 153364985) has the molecular formula C25H30FNO6 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-[2-[4-[(2S,3R,4S,5R,6R)-3,4-dihydroxy-5-methoxy-6-prop-2-enyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[(2S,3R,4S,5R,6R)-3,4-dihydroxy-5-methoxy-6-prop-2-enyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 153364985 |
| Molecular Formula | C25H30FNO6 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | N-[2-[4-[(2S,3R,4S,5R,6R)-3,4-dihydroxy-5-methoxy-6-prop-2-enyloxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide |
| SMILES | C=CC[C@H]1O[C@@H](Oc2ccc(CCNC(C)=O)c(-c3cccc(F)c3)c2)[C@H](O)[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C25H30FNO6/c1-4-6-21-24(31-3)22(29)23(30)25(33-21)32-19-10-9-16(11-12-27-15(2)28)20(14-19)17-7-5-8-18(26)13-17/h4-5,7-10,13-14,21-25,29-30H,1,6,11-12H2,2-3H3,(H,27,28)/t21-,22+,23-,24+,25-/m1/s1 |
| InChIKey | KUBNDLDRLMPOAY-MBWGTIHESA-N |
| XLogP | 2.59 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|