C33H36FNO5 — CID 158410274
[(2S,4R,5R,6S)-2-[4-(2-acetamidoethyl)-3-(3-fluorophenyl)phenoxy]-4,5-dimethyl-6-prop-2-enyloxan-3-yl] benzoate (PubChem CID 158410274) has the molecular formula C33H36FNO5 and a molecular weight of 545.65 g/mol. Its IUPAC name is [(2S,4R,5R,6S)-2-[4-(2-acetamidoethyl)-3-(3-fluorophenyl)phenoxy]-4,5-dimethyl-6-prop-2-enyloxan-3-yl] benzoate.
| Compound Name | [(2S,4R,5R,6S)-2-[4-(2-acetamidoethyl)-3-(3-fluorophenyl)phenoxy]-4,5-dimethyl-6-prop-2-enyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 158410274 |
| Molecular Formula | C33H36FNO5 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | [(2S,4R,5R,6S)-2-[4-(2-acetamidoethyl)-3-(3-fluorophenyl)phenoxy]-4,5-dimethyl-6-prop-2-enyloxan-3-yl] benzoate |
| SMILES | C=CC[C@@H]1O[C@@H](Oc2ccc(CCNC(C)=O)c(-c3cccc(F)c3)c2)C(OC(=O)c2ccccc2)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C33H36FNO5/c1-5-10-30-21(2)22(3)31(40-32(37)25-11-7-6-8-12-25)33(39-30)38-28-16-15-24(17-18-35-23(4)36)29(20-28)26-13-9-14-27(34)19-26/h5-9,11-16,19-22,30-31,33H,1,10,17-18H2,2-4H3,(H,35,36)/t21-,22-,30+,31?,33-/m1/s1 |
| InChIKey | FWWQBCXKPCFEEK-WFOIFUQOSA-N |
| XLogP | 6.35 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|