C26H34FNO6 — CID 170405856
N-[2-[4-[(2R,3R,4S,5R,6R)-6-butyl-3,4-dihydroxy-5-methoxyoxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide (PubChem CID 170405856) has the molecular formula C26H34FNO6 and a molecular weight of 475.56 g/mol. Its IUPAC name is N-[2-[4-[(2R,3R,4S,5R,6R)-6-butyl-3,4-dihydroxy-5-methoxyoxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[(2R,3R,4S,5R,6R)-6-butyl-3,4-dihydroxy-5-methoxyoxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 170405856 |
| Molecular Formula | C26H34FNO6 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[2-[4-[(2R,3R,4S,5R,6R)-6-butyl-3,4-dihydroxy-5-methoxyoxan-2-yl]oxy-2-(3-fluorophenyl)phenyl]ethyl]acetamide |
| SMILES | CCCC[C@H]1O[C@H](Oc2ccc(CCNC(C)=O)c(-c3cccc(F)c3)c2)[C@H](O)[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C26H34FNO6/c1-4-5-9-22-25(32-3)23(30)24(31)26(34-22)33-20-11-10-17(12-13-28-16(2)29)21(15-20)18-7-6-8-19(27)14-18/h6-8,10-11,14-15,22-26,30-31H,4-5,9,12-13H2,1-3H3,(H,28,29)/t22-,23+,24-,25+,26+/m1/s1 |
| InChIKey | RSTFRPMTJHXWQA-NRWDCXGPSA-N |
| XLogP | 3.20 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |