C26H32FNO6 — CID 158691843
N-[2-[4-[[(3aR,4S,6S,7S,7aR)-7-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-(3-fluorophenyl)phenyl]ethyl]acetamide (PubChem CID 158691843) has the molecular formula C26H32FNO6 and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[2-[4-[[(3aR,4S,6S,7S,7aR)-7-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-(3-fluorophenyl)phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[[(3aR,4S,6S,7S,7aR)-7-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-(3-fluorophenyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 158691843 |
| Molecular Formula | C26H32FNO6 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[2-[4-[[(3aR,4S,6S,7S,7aR)-7-methoxy-2,2,6-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-(3-fluorophenyl)phenyl]ethyl]acetamide |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](Oc2ccc(CCNC(C)=O)c(-c3cccc(F)c3)c2)O[C@H]1C |
| InChI | InChI=1S/C26H32FNO6/c1-15-22(30-5)23-24(34-26(3,4)33-23)25(31-15)32-20-10-9-17(11-12-28-16(2)29)21(14-20)18-7-6-8-19(27)13-18/h6-10,13-15,22-25H,11-12H2,1-5H3,(H,28,29)/t15-,22-,23+,24+,25-/m0/s1 |
| InChIKey | GSUIKKABIBHXJN-JPZVKYLOSA-N |
| XLogP | 3.83 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |