C12H20O2 — CID 14712011
[(3E,5E)-2-deuteriohepta-3,5-dien-2-yl] 2,2-dimethylpropanoate (PubChem CID 14712011) has the molecular formula C12H20O2 and a molecular weight of 197.30 g/mol. Its IUPAC name is [(3E,5E)-2-deuteriohepta-3,5-dien-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3E,5E)-2-deuteriohepta-3,5-dien-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14712011 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | [(3E,5E)-2-deuteriohepta-3,5-dien-2-yl] 2,2-dimethylpropanoate |
| SMILES | [2H]C(C)(/C=C/C=C/C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H20O2/c1-6-7-8-9-10(2)14-11(13)12(3,4)5/h6-10H,1-5H3/b7-6+,9-8+/i10D |
| InChIKey | HMKGEBUZWGFJPT-QWKASNRFSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|