C12H18F2O2 — CID 71718649
(6E,8E)-4,4-difluoro-5-hydroxy-2,2-dimethyldeca-6,8-dien-3-one (PubChem CID 71718649) has the molecular formula C12H18F2O2 and a molecular weight of 232.27 g/mol. Its IUPAC name is (6E,8E)-4,4-difluoro-5-hydroxy-2,2-dimethyldeca-6,8-dien-3-one.
| Compound Name | (6E,8E)-4,4-difluoro-5-hydroxy-2,2-dimethyldeca-6,8-dien-3-one |
|---|---|
| PubChem CID | 71718649 |
| Molecular Formula | C12H18F2O2 |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (6E,8E)-4,4-difluoro-5-hydroxy-2,2-dimethyldeca-6,8-dien-3-one |
| SMILES | C/C=C/C=C/C(O)C(F)(F)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H18F2O2/c1-5-6-7-8-9(15)12(13,14)10(16)11(2,3)4/h5-9,15H,1-4H3/b6-5+,8-7+ |
| InChIKey | MJKTVZAPVZOHSG-BSWSSELBSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|