C11H19N4+ — CID 147121078
[1-(3-amino-4-pyridinyl)-4-methylpiperidin-4-yl]azanium (PubChem CID 147121078) has the molecular formula C11H19N4+ and a molecular weight of 207.30 g/mol. Its IUPAC name is [1-(3-amino-4-pyridinyl)-4-methylpiperidin-4-yl]azanium.
| Compound Name | [1-(3-amino-4-pyridinyl)-4-methylpiperidin-4-yl]azanium |
|---|---|
| PubChem CID | 147121078 |
| Molecular Formula | C11H19N4+ |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | [1-(3-amino-4-pyridinyl)-4-methylpiperidin-4-yl]azanium |
| SMILES | CC1([NH3+])CCN(c2ccncc2N)CC1 |
| InChI | InChI=1S/C11H18N4/c1-11(13)3-6-15(7-4-11)10-2-5-14-8-9(10)12/h2,5,8H,3-4,6-7,12-13H2,1H3/p+1 |
| InChIKey | BOJCUPCGWUEADC-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |