C19H30O4 — CID 14715032
3-butyl-2-hex-1-ynyl-1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-ol (PubChem CID 14715032) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-butyl-2-hex-1-ynyl-1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-ol.
| Compound Name | 3-butyl-2-hex-1-ynyl-1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-ol |
|---|---|
| PubChem CID | 14715032 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 3-butyl-2-hex-1-ynyl-1-propan-2-yloxy-5,8-dioxaspiro[3.4]oct-1-en-3-ol |
| SMILES | CCCCC#CC1=C(OC(C)C)C2(OCCO2)C1(O)CCCC |
| InChI | InChI=1S/C19H30O4/c1-5-7-9-10-11-16-17(23-15(3)4)19(21-13-14-22-19)18(16,20)12-8-6-2/h15,20H,5-9,12-14H2,1-4H3 |
| InChIKey | HMZNTUXZQYJKTL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|