C24H48O4P+ — CID 71276911
tributyl-[3-[2-(3-oxo-3-propan-2-yloxypropyl)-1,3-dioxolan-2-yl]propyl]phosphanium (PubChem CID 71276911) has the molecular formula C24H48O4P+ and a molecular weight of 431.62 g/mol. Its IUPAC name is tributyl-[3-[2-(3-oxo-3-propan-2-yloxypropyl)-1,3-dioxolan-2-yl]propyl]phosphanium.
| Compound Name | tributyl-[3-[2-(3-oxo-3-propan-2-yloxypropyl)-1,3-dioxolan-2-yl]propyl]phosphanium |
|---|---|
| PubChem CID | 71276911 |
| Molecular Formula | C24H48O4P+ |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | tributyl-[3-[2-(3-oxo-3-propan-2-yloxypropyl)-1,3-dioxolan-2-yl]propyl]phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC1(CCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C24H48O4P/c1-6-9-18-29(19-10-7-2,20-11-8-3)21-12-14-24(26-16-17-27-24)15-13-23(25)28-22(4)5/h22H,6-21H2,1-5H3/q+1 |
| InChIKey | BOEPIZYUTOHGCN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|