C27H53BrNO5P — CID 140652689
propan-2-yl 3-[2-[3-[3-[bromo(tributyl)-λ5-phosphanyl]propylamino]-3-oxopropyl]-1,3-dioxolan-2-yl]propanoate (PubChem CID 140652689) has the molecular formula C27H53BrNO5P and a molecular weight of 582.60 g/mol. Its IUPAC name is propan-2-yl 3-[2-[3-[3-[bromo(tributyl)-λ5-phosphanyl]propylamino]-3-oxopropyl]-1,3-dioxolan-2-yl]propanoate.
| Compound Name | propan-2-yl 3-[2-[3-[3-[bromo(tributyl)-λ5-phosphanyl]propylamino]-3-oxopropyl]-1,3-dioxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 140652689 |
| Molecular Formula | C27H53BrNO5P |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | propan-2-yl 3-[2-[3-[3-[bromo(tributyl)-λ5-phosphanyl]propylamino]-3-oxopropyl]-1,3-dioxolan-2-yl]propanoate |
| SMILES | CCCCP(Br)(CCCC)(CCCC)CCCNC(=O)CCC1(CCC(=O)OC(C)C)OCCO1 |
| InChI | InChI=1S/C27H53BrNO5P/c1-6-9-20-35(28,21-10-7-2,22-11-8-3)23-12-17-29-25(30)13-15-27(32-18-19-33-27)16-14-26(31)34-24(4)5/h24H,6-23H2,1-5H3,(H,29,30) |
| InChIKey | RVSHVISNUCSKJD-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|