C24H49NO4P+ — CID 66584997
[4-amino-6-[2-(2-carboxyethyl)-1,3-dioxolan-2-yl]hexyl]-tributylphosphanium (PubChem CID 66584997) has the molecular formula C24H49NO4P+ and a molecular weight of 446.63 g/mol. Its IUPAC name is [4-amino-6-[2-(2-carboxyethyl)-1,3-dioxolan-2-yl]hexyl]-tributylphosphanium.
| Compound Name | [4-amino-6-[2-(2-carboxyethyl)-1,3-dioxolan-2-yl]hexyl]-tributylphosphanium |
|---|---|
| PubChem CID | 66584997 |
| Molecular Formula | C24H49NO4P+ |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | [4-amino-6-[2-(2-carboxyethyl)-1,3-dioxolan-2-yl]hexyl]-tributylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC(N)CCC1(CCC(=O)O)OCCO1 |
| InChI | InChI=1S/C24H48NO4P/c1-4-7-18-30(19-8-5-2,20-9-6-3)21-10-11-22(25)12-14-24(15-13-23(26)27)28-16-17-29-24/h22H,4-21,25H2,1-3H3/p+1 |
| InChIKey | SYXXSPHSJRQZFV-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|