C27H18F5N3O5 — CID 147151078
(3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-1-(5-nitro-6-phenylmethoxy-2-pyridinyl)propan-1-one (PubChem CID 147151078) has the molecular formula C27H18F5N3O5 and a molecular weight of 559.45 g/mol. Its IUPAC name is (3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-1-(5-nitro-6-phenylmethoxy-2-pyridinyl)propan-1-one.
| Compound Name | (3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-1-(5-nitro-6-phenylmethoxy-2-pyridinyl)propan-1-one |
|---|---|
| PubChem CID | 147151078 |
| Molecular Formula | C27H18F5N3O5 |
| Molecular Weight | 559.45 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | (3S)-3-(3-fluoro-2-pyridinyl)-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-1-(5-nitro-6-phenylmethoxy-2-pyridinyl)propan-1-one |
| SMILES | O=C(C[C@@H](c1ccc(OC(F)(F)F)c(F)c1)c1ncccc1F)c1ccc([N+](=O)[O-])c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C27H18F5N3O5/c28-19-7-4-12-33-25(19)18(17-8-11-24(20(29)13-17)40-27(30,31)32)14-23(36)21-9-10-22(35(37)38)26(34-21)39-15-16-5-2-1-3-6-16/h1-13,18H,14-15H2/t18-/m0/s1 |
| InChIKey | BTZRDMKJDDBONI-SFHVURJKSA-N |
| XLogP | 6.55 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.45 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|