C25H14I3O4S2+ — CID 147151412
[4-(10,10-dioxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate (PubChem CID 147151412) has the molecular formula C25H14I3O4S2+ and a molecular weight of 823.23 g/mol. Its IUPAC name is [4-(10,10-dioxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate.
| Compound Name | [4-(10,10-dioxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 147151412 |
| Molecular Formula | C25H14I3O4S2+ |
| Molecular Weight | 823.23 g/mol |
| Exact Mass | 822.75 |
| IUPAC Name | [4-(10,10-dioxothianthren-5-ium-5-yl)phenyl] 2,3,6-triiodobenzoate |
| SMILES | O=C(Oc1ccc([S+]2c3ccccc3S(=O)(=O)c3ccccc32)cc1)c1c(I)ccc(I)c1I |
| InChI | InChI=1S/C25H14I3O4S2/c26-17-13-14-18(27)24(28)23(17)25(29)32-15-9-11-16(12-10-15)33-19-5-1-3-7-21(19)34(30,31)22-8-4-2-6-20(22)33/h1-14H/q+1 |
| InChIKey | BUBHCCBXHCBUMS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.23 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|