C24H20F3NO5S — CID 147159855
[5-[2-(3-methyl-4-sulfamoylphenyl)acetyl]-2-[2-(trifluoromethyl)phenyl]phenyl] acetate (PubChem CID 147159855) has the molecular formula C24H20F3NO5S and a molecular weight of 491.49 g/mol. Its IUPAC name is [5-[2-(3-methyl-4-sulfamoylphenyl)acetyl]-2-[2-(trifluoromethyl)phenyl]phenyl] acetate.
| Compound Name | [5-[2-(3-methyl-4-sulfamoylphenyl)acetyl]-2-[2-(trifluoromethyl)phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 147159855 |
| Molecular Formula | C24H20F3NO5S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | [5-[2-(3-methyl-4-sulfamoylphenyl)acetyl]-2-[2-(trifluoromethyl)phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(C(=O)Cc2ccc(S(N)(=O)=O)c(C)c2)ccc1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H20F3NO5S/c1-14-11-16(7-10-23(14)34(28,31)32)12-21(30)17-8-9-19(22(13-17)33-15(2)29)18-5-3-4-6-20(18)24(25,26)27/h3-11,13H,12H2,1-2H3,(H2,28,31,32) |
| InChIKey | BVPWDYODBAFTMQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|