C21H25NO3 — CID 147160619
benzyl 2-[4-[(1R,3S,5S)-3-hydroxy-5-methylcyclohexyl]-3-pyridinyl]acetate (PubChem CID 147160619) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is benzyl 2-[4-[(1R,3S,5S)-3-hydroxy-5-methylcyclohexyl]-3-pyridinyl]acetate.
| Compound Name | benzyl 2-[4-[(1R,3S,5S)-3-hydroxy-5-methylcyclohexyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 147160619 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | benzyl 2-[4-[(1R,3S,5S)-3-hydroxy-5-methylcyclohexyl]-3-pyridinyl]acetate |
| SMILES | C[C@@H]1C[C@H](O)C[C@H](c2ccncc2CC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H25NO3/c1-15-9-17(11-19(23)10-15)20-7-8-22-13-18(20)12-21(24)25-14-16-5-3-2-4-6-16/h2-8,13,15,17,19,23H,9-12,14H2,1H3/t15-,17+,19-/m0/s1 |
| InChIKey | BVTOCOCVNWYTGC-WDYCEAGBSA-N |
| XLogP | 3.63 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |