C26H24N2O2 — CID 147162606
2-[4-methoxy-2-methyl-1-[(2-phenylphenyl)methyl]indol-3-yl]-N-methylideneacetamide (PubChem CID 147162606) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is 2-[4-methoxy-2-methyl-1-[(2-phenylphenyl)methyl]indol-3-yl]-N-methylideneacetamide.
| Compound Name | 2-[4-methoxy-2-methyl-1-[(2-phenylphenyl)methyl]indol-3-yl]-N-methylideneacetamide |
|---|---|
| PubChem CID | 147162606 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 2-[4-methoxy-2-methyl-1-[(2-phenylphenyl)methyl]indol-3-yl]-N-methylideneacetamide |
| SMILES | C=NC(=O)Cc1c(C)n(Cc2ccccc2-c2ccccc2)c2cccc(OC)c12 |
| InChI | InChI=1S/C26H24N2O2/c1-18-22(16-25(29)27-2)26-23(14-9-15-24(26)30-3)28(18)17-20-12-7-8-13-21(20)19-10-5-4-6-11-19/h4-15H,2,16-17H2,1,3H3 |
| InChIKey | BWDCZORSEYXLMW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|