C5H9NO2 — CID 147164139
2,4-dimethyl-5H-1,2-oxazol-5-ol (PubChem CID 147164139) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is 2,4-dimethyl-5H-1,2-oxazol-5-ol.
| Compound Name | 2,4-dimethyl-5H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 147164139 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 2,4-dimethyl-5H-1,2-oxazol-5-ol |
| SMILES | CC1=CN(C)OC1O |
| InChI | InChI=1S/C5H9NO2/c1-4-3-6(2)8-5(4)7/h3,5,7H,1-2H3 |
| InChIKey | BWKQZZRIIUYFII-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |