C24H26N6O3 — CID 147167393
1-(3-amino-1-methyliminobut-2-en-2-yl)-8-[6-(3-hydroxypropoxy)-3-pyridinyl]-3-methylimidazo[4,5-c]quinolin-2-one (PubChem CID 147167393) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-(3-amino-1-methyliminobut-2-en-2-yl)-8-[6-(3-hydroxypropoxy)-3-pyridinyl]-3-methylimidazo[4,5-c]quinolin-2-one.
| Compound Name | 1-(3-amino-1-methyliminobut-2-en-2-yl)-8-[6-(3-hydroxypropoxy)-3-pyridinyl]-3-methylimidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 147167393 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-(3-amino-1-methyliminobut-2-en-2-yl)-8-[6-(3-hydroxypropoxy)-3-pyridinyl]-3-methylimidazo[4,5-c]quinolin-2-one |
| SMILES | C/N=C/C(=C(C)N)n1c(=O)n(C)c2cnc3ccc(-c4ccc(OCCCO)nc4)cc3c21 |
| InChI | InChI=1S/C24H26N6O3/c1-15(25)20(13-26-2)30-23-18-11-16(17-6-8-22(28-12-17)33-10-4-9-31)5-7-19(18)27-14-21(23)29(3)24(30)32/h5-8,11-14,31H,4,9-10,25H2,1-3H3/b20-15?,26-13+ |
| InChIKey | MFWRSQBJIPBBFZ-SWICYNAMSA-N |
| XLogP | 2.56 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|