C12H14N4OS — CID 147200014
2-(5-methyl-2-pyridinyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one (PubChem CID 147200014) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridinyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one.
| Compound Name | 2-(5-methyl-2-pyridinyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one |
|---|---|
| PubChem CID | 147200014 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(5-methyl-2-pyridinyl)-3-sulfanylidene-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,2-a]pyridazin-1-one |
| SMILES | Cc1ccc(-n2c(=O)n3n(c2=S)CCCC3)nc1 |
| InChI | InChI=1S/C12H14N4OS/c1-9-4-5-10(13-8-9)16-11(17)14-6-2-3-7-15(14)12(16)18/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | CDCYIZZZWIILDB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|