C15H19F2N5O — CID 147217008
1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]-5-imino-2H-pyrrol-3-ol (PubChem CID 147217008) has the molecular formula C15H19F2N5O and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]-5-imino-2H-pyrrol-3-ol.
| Compound Name | 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 147217008 |
| Molecular Formula | C15H19F2N5O |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[4-[(4,4-difluorocyclohexyl)amino]-6-methylpyrimidin-2-yl]-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1\C=C(O)CN1c1nc(C)cc(NC2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C15H19F2N5O/c1-9-6-13(20-10-2-4-15(16,17)5-3-10)21-14(19-9)22-8-11(23)7-12(22)18/h6-7,10,18,23H,2-5,8H2,1H3,(H,19,20,21)/b18-12+ |
| InChIKey | IGBHHIXQOJRPGD-LDADJPATSA-N |
| XLogP | 3.01 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|