C18H20F5N2O8P — CID 147227257
[(2R,3R,4S,5R)-5-[3-[2-(2,4-difluorophenyl)ethyl]-2-oxo-5-(trifluoromethyl)-4H-pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 147227257) has the molecular formula C18H20F5N2O8P and a molecular weight of 518.33 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-[3-[2-(2,4-difluorophenyl)ethyl]-2-oxo-5-(trifluoromethyl)-4H-pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5R)-5-[3-[2-(2,4-difluorophenyl)ethyl]-2-oxo-5-(trifluoromethyl)-4H-pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 147227257 |
| Molecular Formula | C18H20F5N2O8P |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | [(2R,3R,4S,5R)-5-[3-[2-(2,4-difluorophenyl)ethyl]-2-oxo-5-(trifluoromethyl)-4H-pyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C1N(CCc2ccc(F)cc2F)CC(C(F)(F)F)=CN1[C@@H]1O[C@H](COP(=O)(O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20F5N2O8P/c19-11-2-1-9(12(20)5-11)3-4-24-6-10(18(21,22)23)7-25(17(24)28)16-15(27)14(26)13(33-16)8-32-34(29,30)31/h1-2,5,7,13-16,26-27H,3-4,6,8H2,(H2,29,30,31)/t13-,14+,15+,16-/m1/s1 |
| InChIKey | CIFKGZYEICQWSQ-FXUDXRNXSA-N |
| XLogP | 1.25 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|